C20H14ClFINO2 — CID 23098079
(E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-(2-fluoro-4-iodophenyl)prop-2-enamide (PubChem CID 23098079) has the molecular formula C20H14ClFINO2 and a molecular weight of 481.69 g/mol. Its IUPAC name is (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-(2-fluoro-4-iodophenyl)prop-2-enamide.
| Compound Name | (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-(2-fluoro-4-iodophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 23098079 |
| Molecular Formula | C20H14ClFINO2 |
| Molecular Weight | 481.69 g/mol |
| Exact Mass | 480.97 |
| IUPAC Name | (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-(2-fluoro-4-iodophenyl)prop-2-enamide |
| SMILES | Cc1ccc(-c2ccc(/C=C/C(=O)Nc3ccc(I)cc3F)o2)cc1Cl |
| InChI | InChI=1S/C20H14ClFINO2/c1-12-2-3-13(10-16(12)21)19-8-5-15(26-19)6-9-20(25)24-18-7-4-14(23)11-17(18)22/h2-11H,1H3,(H,24,25)/b9-6+ |
| InChIKey | VMVAVCDVLGUMFE-RMKNXTFCSA-N |
| XLogP | 6.30 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.69 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|