C21H14Cl3NO4 — CID 28678379
2,4-dichloro-5-[[(E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enoyl]amino]benzoic acid (PubChem CID 28678379) has the molecular formula C21H14Cl3NO4 and a molecular weight of 450.71 g/mol. Its IUPAC name is 2,4-dichloro-5-[[(E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enoyl]amino]benzoic acid.
| Compound Name | 2,4-dichloro-5-[[(E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 28678379 |
| Molecular Formula | C21H14Cl3NO4 |
| Molecular Weight | 450.71 g/mol |
| Exact Mass | 449.00 |
| IUPAC Name | 2,4-dichloro-5-[[(E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]prop-2-enoyl]amino]benzoic acid |
| SMILES | Cc1ccc(-c2ccc(/C=C/C(=O)Nc3cc(C(=O)O)c(Cl)cc3Cl)o2)cc1Cl |
| InChI | InChI=1S/C21H14Cl3NO4/c1-11-2-3-12(8-15(11)22)19-6-4-13(29-19)5-7-20(26)25-18-9-14(21(27)28)16(23)10-17(18)24/h2-10H,1H3,(H,25,26)(H,27,28)/b7-5+ |
| InChIKey | UYAGLZSRDNVQTA-FNORWQNLSA-N |
| XLogP | 6.57 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.71 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|