C20H15ClFNO2 — CID 3913972
3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-(2-fluorophenyl)prop-2-enamide (PubChem CID 3913972) has the molecular formula C20H15ClFNO2 and a molecular weight of 355.80 g/mol. Its IUPAC name is 3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-(2-fluorophenyl)prop-2-enamide.
| Compound Name | 3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-(2-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3913972 |
| Molecular Formula | C20H15ClFNO2 |
| Molecular Weight | 355.80 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-(2-fluorophenyl)prop-2-enamide |
| SMILES | Cc1ccc(-c2ccc(C=CC(=O)Nc3ccccc3F)o2)cc1Cl |
| InChI | InChI=1S/C20H15ClFNO2/c1-13-6-7-14(12-16(13)21)19-10-8-15(25-19)9-11-20(24)23-18-5-3-2-4-17(18)22/h2-12H,1H3,(H,23,24) |
| InChIKey | RRNLEKGAOVSZOA-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.80 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|