C25H26ClN3O4S — CID 23100030
(E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[2-(4-methylsulfonylpiperazin-1-yl)phenyl]prop-2-enamide (PubChem CID 23100030) has the molecular formula C25H26ClN3O4S and a molecular weight of 500.02 g/mol. Its IUPAC name is (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[2-(4-methylsulfonylpiperazin-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[2-(4-methylsulfonylpiperazin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 23100030 |
| Molecular Formula | C25H26ClN3O4S |
| Molecular Weight | 500.02 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[2-(4-methylsulfonylpiperazin-1-yl)phenyl]prop-2-enamide |
| SMILES | Cc1ccc(-c2ccc(/C=C/C(=O)Nc3ccccc3N3CCN(S(C)(=O)=O)CC3)o2)cc1Cl |
| InChI | InChI=1S/C25H26ClN3O4S/c1-18-7-8-19(17-21(18)26)24-11-9-20(33-24)10-12-25(30)27-22-5-3-4-6-23(22)28-13-15-29(16-14-28)34(2,31)32/h3-12,17H,13-16H2,1-2H3,(H,27,30)/b12-10+ |
| InChIKey | ZZESHBNBXPNNMK-ZRDIBKRKSA-N |
| XLogP | 4.64 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.02 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|