C27H28ClN3O2S — CID 23099437
(E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[[2-(4-methylpiperidin-1-yl)phenyl]carbamothioyl]prop-2-enamide (PubChem CID 23099437) has the molecular formula C27H28ClN3O2S and a molecular weight of 494.06 g/mol. Its IUPAC name is (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[[2-(4-methylpiperidin-1-yl)phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[[2-(4-methylpiperidin-1-yl)phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 23099437 |
| Molecular Formula | C27H28ClN3O2S |
| Molecular Weight | 494.06 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[[2-(4-methylpiperidin-1-yl)phenyl]carbamothioyl]prop-2-enamide |
| SMILES | Cc1ccc(-c2ccc(/C=C/C(=O)NC(=S)Nc3ccccc3N3CCC(C)CC3)o2)cc1Cl |
| InChI | InChI=1S/C27H28ClN3O2S/c1-18-13-15-31(16-14-18)24-6-4-3-5-23(24)29-27(34)30-26(32)12-10-21-9-11-25(33-21)20-8-7-19(2)22(28)17-20/h3-12,17-18H,13-16H2,1-2H3,(H2,29,30,32,34)/b12-10+ |
| InChIKey | ZHGQTOGUERPMCM-ZRDIBKRKSA-N |
| XLogP | 6.67 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.06 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|