C25H23Cl2N3O2S — CID 17115713
(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[(2-piperidin-1-ylphenyl)carbamothioyl]prop-2-enamide (PubChem CID 17115713) has the molecular formula C25H23Cl2N3O2S and a molecular weight of 500.45 g/mol. Its IUPAC name is (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[(2-piperidin-1-ylphenyl)carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[(2-piperidin-1-ylphenyl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 17115713 |
| Molecular Formula | C25H23Cl2N3O2S |
| Molecular Weight | 500.45 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[(2-piperidin-1-ylphenyl)carbamothioyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2cc(Cl)cc(Cl)c2)o1)NC(=S)Nc1ccccc1N1CCCCC1 |
| InChI | InChI=1S/C25H23Cl2N3O2S/c26-18-14-17(15-19(27)16-18)23-10-8-20(32-23)9-11-24(31)29-25(33)28-21-6-2-3-7-22(21)30-12-4-1-5-13-30/h2-3,6-11,14-16H,1,4-5,12-13H2,(H2,28,29,31,33)/b11-9+ |
| InChIKey | SVILGCQKXJXYMX-PKNBQFBNSA-N |
| XLogP | 6.77 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.45 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|