C30H24Cl3N3O3 — CID 17319208
(E)-N-[2-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 17319208) has the molecular formula C30H24Cl3N3O3 and a molecular weight of 580.90 g/mol. Its IUPAC name is (E)-N-[2-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[2-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17319208 |
| Molecular Formula | C30H24Cl3N3O3 |
| Molecular Weight | 580.90 g/mol |
| Exact Mass | 579.09 |
| IUPAC Name | (E)-N-[2-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2cc(Cl)cc(Cl)c2)o1)Nc1ccccc1N1CCN(C(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C30H24Cl3N3O3/c31-22-7-5-20(6-8-22)30(38)36-15-13-35(14-16-36)27-4-2-1-3-26(27)34-29(37)12-10-25-9-11-28(39-25)21-17-23(32)19-24(33)18-21/h1-12,17-19H,13-16H2,(H,34,37)/b12-10+ |
| InChIKey | QVNSMUFBDXCCOO-ZRDIBKRKSA-N |
| XLogP | 7.52 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.90 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|