C31H27Cl2N3O3 — CID 17066273
(E)-N-[3-chloro-2-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 17066273) has the molecular formula C31H27Cl2N3O3 and a molecular weight of 560.48 g/mol. Its IUPAC name is (E)-N-[3-chloro-2-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[3-chloro-2-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17066273 |
| Molecular Formula | C31H27Cl2N3O3 |
| Molecular Weight | 560.48 g/mol |
| Exact Mass | 559.14 |
| IUPAC Name | (E)-N-[3-chloro-2-[4-(4-methylbenzoyl)piperazin-1-yl]phenyl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | Cc1ccc(C(=O)N2CCN(c3c(Cl)cccc3NC(=O)/C=C/c3ccc(-c4ccc(Cl)cc4)o3)CC2)cc1 |
| InChI | InChI=1S/C31H27Cl2N3O3/c1-21-5-7-23(8-6-21)31(38)36-19-17-35(18-20-36)30-26(33)3-2-4-27(30)34-29(37)16-14-25-13-15-28(39-25)22-9-11-24(32)12-10-22/h2-16H,17-20H2,1H3,(H,34,37)/b16-14+ |
| InChIKey | RXIYXHWMYHFNCI-JQIJEIRASA-N |
| XLogP | 7.18 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.48 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|