C32H30ClN3O3 — CID 17358570
(E)-3-[5-(4-chlorophenyl)furan-2-yl]-N-[4-[4-(4-ethylbenzoyl)piperazin-1-yl]phenyl]prop-2-enamide (PubChem CID 17358570) has the molecular formula C32H30ClN3O3 and a molecular weight of 540.06 g/mol. Its IUPAC name is (E)-3-[5-(4-chlorophenyl)furan-2-yl]-N-[4-[4-(4-ethylbenzoyl)piperazin-1-yl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(4-chlorophenyl)furan-2-yl]-N-[4-[4-(4-ethylbenzoyl)piperazin-1-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 17358570 |
| Molecular Formula | C32H30ClN3O3 |
| Molecular Weight | 540.06 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | (E)-3-[5-(4-chlorophenyl)furan-2-yl]-N-[4-[4-(4-ethylbenzoyl)piperazin-1-yl]phenyl]prop-2-enamide |
| SMILES | CCc1ccc(C(=O)N2CCN(c3ccc(NC(=O)/C=C/c4ccc(-c5ccc(Cl)cc5)o4)cc3)CC2)cc1 |
| InChI | InChI=1S/C32H30ClN3O3/c1-2-23-3-5-25(6-4-23)32(38)36-21-19-35(20-22-36)28-13-11-27(12-14-28)34-31(37)18-16-29-15-17-30(39-29)24-7-9-26(33)10-8-24/h3-18H,2,19-22H2,1H3,(H,34,37)/b18-16+ |
| InChIKey | DJRXDGXLVARHBI-FBMGVBCBSA-N |
| XLogP | 6.78 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.06 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|