C29H25ClN4O4S — CID 17317979
(E)-3-[5-(4-chlorophenyl)furan-2-yl]-N-[[4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]prop-2-enamide (PubChem CID 17317979) has the molecular formula C29H25ClN4O4S and a molecular weight of 561.06 g/mol. Its IUPAC name is (E)-3-[5-(4-chlorophenyl)furan-2-yl]-N-[[4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(4-chlorophenyl)furan-2-yl]-N-[[4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 17317979 |
| Molecular Formula | C29H25ClN4O4S |
| Molecular Weight | 561.06 g/mol |
| Exact Mass | 560.13 |
| IUPAC Name | (E)-3-[5-(4-chlorophenyl)furan-2-yl]-N-[[4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2ccc(Cl)cc2)o1)NC(=S)Nc1ccc(N2CCN(C(=O)c3ccco3)CC2)cc1 |
| InChI | InChI=1S/C29H25ClN4O4S/c30-21-5-3-20(4-6-21)25-13-11-24(38-25)12-14-27(35)32-29(39)31-22-7-9-23(10-8-22)33-15-17-34(18-16-33)28(36)26-2-1-19-37-26/h1-14,19H,15-18H2,(H2,31,32,35,39)/b14-12+ |
| InChIKey | WFLBJHLDTWZUJT-WYMLVPIESA-N |
| XLogP | 5.68 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.06 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|