C25H22Cl2N4O3S — CID 17318032
(E)-N-[[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-3-(4-chlorophenyl)prop-2-enamide (PubChem CID 17318032) has the molecular formula C25H22Cl2N4O3S and a molecular weight of 529.45 g/mol. Its IUPAC name is (E)-N-[[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-3-(4-chlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-3-(4-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17318032 |
| Molecular Formula | C25H22Cl2N4O3S |
| Molecular Weight | 529.45 g/mol |
| Exact Mass | 528.08 |
| IUPAC Name | (E)-N-[[3-chloro-4-[4-(furan-2-carbonyl)piperazin-1-yl]phenyl]carbamothioyl]-3-(4-chlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)NC(=S)Nc1ccc(N2CCN(C(=O)c3ccco3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C25H22Cl2N4O3S/c26-18-6-3-17(4-7-18)5-10-23(32)29-25(35)28-19-8-9-21(20(27)16-19)30-11-13-31(14-12-30)24(33)22-2-1-15-34-22/h1-10,15-16H,11-14H2,(H2,28,29,32,35)/b10-5+ |
| InChIKey | WLOLTHCDUHSRSD-BJMVGYQFSA-N |
| XLogP | 5.08 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.45 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|