C22H24Cl2N4OS — CID 17110223
(E)-N-[[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]-3-(4-chlorophenyl)prop-2-enamide (PubChem CID 17110223) has the molecular formula C22H24Cl2N4OS and a molecular weight of 463.43 g/mol. Its IUPAC name is (E)-N-[[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]-3-(4-chlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]-3-(4-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17110223 |
| Molecular Formula | C22H24Cl2N4OS |
| Molecular Weight | 463.43 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | (E)-N-[[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]-3-(4-chlorophenyl)prop-2-enamide |
| SMILES | CCN1CCN(c2ccc(NC(=S)NC(=O)/C=C/c3ccc(Cl)cc3)cc2Cl)CC1 |
| InChI | InChI=1S/C22H24Cl2N4OS/c1-2-27-11-13-28(14-12-27)20-9-8-18(15-19(20)24)25-22(30)26-21(29)10-5-16-3-6-17(23)7-4-16/h3-10,15H,2,11-14H2,1H3,(H2,25,26,29,30)/b10-5+ |
| InChIKey | AFXHIFGKMXZKIA-BJMVGYQFSA-N |
| XLogP | 4.66 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|