C20H15ClN2OS — CID 17232261
(E)-3-(4-chlorophenyl)-N-(naphthalen-2-ylcarbamothioyl)prop-2-enamide (PubChem CID 17232261) has the molecular formula C20H15ClN2OS and a molecular weight of 366.87 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-(naphthalen-2-ylcarbamothioyl)prop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-(naphthalen-2-ylcarbamothioyl)prop-2-enamide |
|---|---|
| PubChem CID | 17232261 |
| Molecular Formula | C20H15ClN2OS |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-(naphthalen-2-ylcarbamothioyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)NC(=S)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H15ClN2OS/c21-17-9-5-14(6-10-17)7-12-19(24)23-20(25)22-18-11-8-15-3-1-2-4-16(15)13-18/h1-13H,(H2,22,23,24,25)/b12-7+ |
| InChIKey | VTYKAJSSJCHUTH-KPKJPENVSA-N |
| XLogP | 5.02 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|