C27H26ClN3O2S — CID 17232567
4-tert-butyl-N-[3-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]carbamothioylamino]phenyl]benzamide (PubChem CID 17232567) has the molecular formula C27H26ClN3O2S and a molecular weight of 492.04 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]carbamothioylamino]phenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[3-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]carbamothioylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 17232567 |
| Molecular Formula | C27H26ClN3O2S |
| Molecular Weight | 492.04 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | 4-tert-butyl-N-[3-[[(E)-3-(4-chlorophenyl)prop-2-enoyl]carbamothioylamino]phenyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2cccc(NC(=S)NC(=O)/C=C/c3ccc(Cl)cc3)c2)cc1 |
| InChI | InChI=1S/C27H26ClN3O2S/c1-27(2,3)20-12-10-19(11-13-20)25(33)29-22-5-4-6-23(17-22)30-26(34)31-24(32)16-9-18-7-14-21(28)15-8-18/h4-17H,1-3H3,(H,29,33)(H2,30,31,32,34)/b16-9+ |
| InChIKey | PZJDGYGUKJGVHD-CXUHLZMHSA-N |
| XLogP | 6.42 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.04 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|