C25H21ClN4O3S — CID 17195879
N-[4-[[[(E)-3-(4-chlorophenyl)prop-2-enoyl]carbamothioylamino]carbamoyl]phenyl]-3-methylbenzamide (PubChem CID 17195879) has the molecular formula C25H21ClN4O3S and a molecular weight of 492.99 g/mol. Its IUPAC name is N-[4-[[[(E)-3-(4-chlorophenyl)prop-2-enoyl]carbamothioylamino]carbamoyl]phenyl]-3-methylbenzamide.
| Compound Name | N-[4-[[[(E)-3-(4-chlorophenyl)prop-2-enoyl]carbamothioylamino]carbamoyl]phenyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 17195879 |
| Molecular Formula | C25H21ClN4O3S |
| Molecular Weight | 492.99 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | N-[4-[[[(E)-3-(4-chlorophenyl)prop-2-enoyl]carbamothioylamino]carbamoyl]phenyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc(C(=O)NNC(=S)NC(=O)/C=C/c3ccc(Cl)cc3)cc2)c1 |
| InChI | InChI=1S/C25H21ClN4O3S/c1-16-3-2-4-19(15-16)23(32)27-21-12-8-18(9-13-21)24(33)29-30-25(34)28-22(31)14-7-17-5-10-20(26)11-6-17/h2-15H,1H3,(H,27,32)(H,29,33)(H2,28,30,31,34)/b14-7+ |
| InChIKey | VGKJCQKRRQBCQF-VGOFMYFVSA-N |
| XLogP | 4.25 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.99 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|