C24H21N3O2S — CID 3264059
3-(4-methylphenyl)-N-[[(4-phenylbenzoyl)amino]carbamothioyl]prop-2-enamide (PubChem CID 3264059) has the molecular formula C24H21N3O2S and a molecular weight of 415.52 g/mol. Its IUPAC name is 3-(4-methylphenyl)-N-[[(4-phenylbenzoyl)amino]carbamothioyl]prop-2-enamide.
| Compound Name | 3-(4-methylphenyl)-N-[[(4-phenylbenzoyl)amino]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 3264059 |
| Molecular Formula | C24H21N3O2S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 3-(4-methylphenyl)-N-[[(4-phenylbenzoyl)amino]carbamothioyl]prop-2-enamide |
| SMILES | Cc1ccc(C=CC(=O)NC(=S)NNC(=O)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C24H21N3O2S/c1-17-7-9-18(10-8-17)11-16-22(28)25-24(30)27-26-23(29)21-14-12-20(13-15-21)19-5-3-2-4-6-19/h2-16H,1H3,(H,26,29)(H2,25,27,28,30) |
| InChIKey | ZEZSTCPZNWSTND-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|