C21H22N4O3S — CID 3264075
3-(4-methylphenyl)-N-[[[4-(propanoylamino)benzoyl]amino]carbamothioyl]prop-2-enamide (PubChem CID 3264075) has the molecular formula C21H22N4O3S and a molecular weight of 410.50 g/mol. Its IUPAC name is 3-(4-methylphenyl)-N-[[[4-(propanoylamino)benzoyl]amino]carbamothioyl]prop-2-enamide.
| Compound Name | 3-(4-methylphenyl)-N-[[[4-(propanoylamino)benzoyl]amino]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 3264075 |
| Molecular Formula | C21H22N4O3S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 3-(4-methylphenyl)-N-[[[4-(propanoylamino)benzoyl]amino]carbamothioyl]prop-2-enamide |
| SMILES | CCC(=O)Nc1ccc(C(=O)NNC(=S)NC(=O)C=Cc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H22N4O3S/c1-3-18(26)22-17-11-9-16(10-12-17)20(28)24-25-21(29)23-19(27)13-8-15-6-4-14(2)5-7-15/h4-13H,3H2,1-2H3,(H,22,26)(H,24,28)(H2,23,25,27,29) |
| InChIKey | SNQSPIVYLTUZGA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|