C19H18N4O3S — CID 6122724
(E)-N-[[(4-acetamidobenzoyl)amino]carbamothioyl]-3-phenylprop-2-enamide (PubChem CID 6122724) has the molecular formula C19H18N4O3S and a molecular weight of 382.45 g/mol. Its IUPAC name is (E)-N-[[(4-acetamidobenzoyl)amino]carbamothioyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[[(4-acetamidobenzoyl)amino]carbamothioyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 6122724 |
| Molecular Formula | C19H18N4O3S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | (E)-N-[[(4-acetamidobenzoyl)amino]carbamothioyl]-3-phenylprop-2-enamide |
| SMILES | CC(=O)Nc1ccc(C(=O)NNC(=S)NC(=O)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C19H18N4O3S/c1-13(24)20-16-10-8-15(9-11-16)18(26)22-23-19(27)21-17(25)12-7-14-5-3-2-4-6-14/h2-12H,1H3,(H,20,24)(H,22,26)(H2,21,23,25,27)/b12-7+ |
| InChIKey | MJJIMRJXWJQKIT-KPKJPENVSA-N |
| XLogP | 1.99 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|