C18H16N2O2S — CID 786688
(E)-N-[(4-acetylphenyl)carbamothioyl]-3-phenylprop-2-enamide (PubChem CID 786688) has the molecular formula C18H16N2O2S and a molecular weight of 324.41 g/mol. Its IUPAC name is (E)-N-[(4-acetylphenyl)carbamothioyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(4-acetylphenyl)carbamothioyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 786688 |
| Molecular Formula | C18H16N2O2S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | (E)-N-[(4-acetylphenyl)carbamothioyl]-3-phenylprop-2-enamide |
| SMILES | CC(=O)c1ccc(NC(=S)NC(=O)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C18H16N2O2S/c1-13(21)15-8-10-16(11-9-15)19-18(23)20-17(22)12-7-14-5-3-2-4-6-14/h2-12H,1H3,(H2,19,20,22,23)/b12-7+ |
| InChIKey | GUEQNBQXPIJJTA-KPKJPENVSA-N |
| XLogP | 3.42 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|