C16H22N4O3S — CID 4925761
N-[[[4-(propanoylamino)benzoyl]amino]carbamothioyl]pentanamide (PubChem CID 4925761) has the molecular formula C16H22N4O3S and a molecular weight of 350.44 g/mol. Its IUPAC name is N-[[[4-(propanoylamino)benzoyl]amino]carbamothioyl]pentanamide.
| Compound Name | N-[[[4-(propanoylamino)benzoyl]amino]carbamothioyl]pentanamide |
|---|---|
| PubChem CID | 4925761 |
| Molecular Formula | C16H22N4O3S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | N-[[[4-(propanoylamino)benzoyl]amino]carbamothioyl]pentanamide |
| SMILES | CCCCC(=O)NC(=S)NNC(=O)c1ccc(NC(=O)CC)cc1 |
| InChI | InChI=1S/C16H22N4O3S/c1-3-5-6-14(22)18-16(24)20-19-15(23)11-7-9-12(10-8-11)17-13(21)4-2/h7-10H,3-6H2,1-2H3,(H,17,21)(H,19,23)(H2,18,20,22,24) |
| InChIKey | LTNJVFGMXBVBFP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|