C14H15N3O4S — CID 3489168
ethyl 4-(benzamidocarbamothioylamino)-4-oxobut-2-enoate (PubChem CID 3489168) has the molecular formula C14H15N3O4S and a molecular weight of 321.36 g/mol. Its IUPAC name is ethyl 4-(benzamidocarbamothioylamino)-4-oxobut-2-enoate.
| Compound Name | ethyl 4-(benzamidocarbamothioylamino)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 3489168 |
| Molecular Formula | C14H15N3O4S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | ethyl 4-(benzamidocarbamothioylamino)-4-oxobut-2-enoate |
| SMILES | CCOC(=O)C=CC(=O)NC(=S)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H15N3O4S/c1-2-21-12(19)9-8-11(18)15-14(22)17-16-13(20)10-6-4-3-5-7-10/h3-9H,2H2,1H3,(H,16,20)(H2,15,17,18,22) |
| InChIKey | DSFXCDQBIVJFLI-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|