C18H23N3O5S — CID 4930348
ethyl 4-[[[4-(2-methylpropoxy)benzoyl]amino]carbamothioylamino]-4-oxobut-2-enoate (PubChem CID 4930348) has the molecular formula C18H23N3O5S and a molecular weight of 393.47 g/mol. Its IUPAC name is ethyl 4-[[[4-(2-methylpropoxy)benzoyl]amino]carbamothioylamino]-4-oxobut-2-enoate.
| Compound Name | ethyl 4-[[[4-(2-methylpropoxy)benzoyl]amino]carbamothioylamino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 4930348 |
| Molecular Formula | C18H23N3O5S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | ethyl 4-[[[4-(2-methylpropoxy)benzoyl]amino]carbamothioylamino]-4-oxobut-2-enoate |
| SMILES | CCOC(=O)C=CC(=O)NC(=S)NNC(=O)c1ccc(OCC(C)C)cc1 |
| InChI | InChI=1S/C18H23N3O5S/c1-4-25-16(23)10-9-15(22)19-18(27)21-20-17(24)13-5-7-14(8-6-13)26-11-12(2)3/h5-10,12H,4,11H2,1-3H3,(H,20,24)(H2,19,21,22,27) |
| InChIKey | NJDASQNLBLWPAJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|