C22H27N3O6S — CID 4930269
3,4,5-trimethoxy-N-[[[4-(2-methylpropoxy)benzoyl]amino]carbamothioyl]benzamide (PubChem CID 4930269) has the molecular formula C22H27N3O6S and a molecular weight of 461.54 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[[[4-(2-methylpropoxy)benzoyl]amino]carbamothioyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[[[4-(2-methylpropoxy)benzoyl]amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4930269 |
| Molecular Formula | C22H27N3O6S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 3,4,5-trimethoxy-N-[[[4-(2-methylpropoxy)benzoyl]amino]carbamothioyl]benzamide |
| SMILES | COc1cc(C(=O)NC(=S)NNC(=O)c2ccc(OCC(C)C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C22H27N3O6S/c1-13(2)12-31-16-8-6-14(7-9-16)21(27)24-25-22(32)23-20(26)15-10-17(28-3)19(30-5)18(11-15)29-4/h6-11,13H,12H2,1-5H3,(H,24,27)(H2,23,25,26,32) |
| InChIKey | ZKHVKUVNSVIUGM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 107.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|