C25H24N4O6S — CID 3934727
N-[[(4-benzamidobenzoyl)amino]carbamothioyl]-3,4,5-trimethoxybenzamide (PubChem CID 3934727) has the molecular formula C25H24N4O6S and a molecular weight of 508.56 g/mol. Its IUPAC name is N-[[(4-benzamidobenzoyl)amino]carbamothioyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[[(4-benzamidobenzoyl)amino]carbamothioyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 3934727 |
| Molecular Formula | C25H24N4O6S |
| Molecular Weight | 508.56 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | N-[[(4-benzamidobenzoyl)amino]carbamothioyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NC(=S)NNC(=O)c2ccc(NC(=O)c3ccccc3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C25H24N4O6S/c1-33-19-13-17(14-20(34-2)21(19)35-3)23(31)27-25(36)29-28-24(32)16-9-11-18(12-10-16)26-22(30)15-7-5-4-6-8-15/h4-14H,1-3H3,(H,26,30)(H,28,32)(H2,27,29,31,36) |
| InChIKey | QDUZXDZVAIASJB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 127.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.56 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|