C25H23BrN4O4S — CID 17356122
N-[[(4-benzamidobenzoyl)amino]carbamothioyl]-3-bromo-4-propan-2-yloxybenzamide (PubChem CID 17356122) has the molecular formula C25H23BrN4O4S and a molecular weight of 555.45 g/mol. Its IUPAC name is N-[[(4-benzamidobenzoyl)amino]carbamothioyl]-3-bromo-4-propan-2-yloxybenzamide.
| Compound Name | N-[[(4-benzamidobenzoyl)amino]carbamothioyl]-3-bromo-4-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 17356122 |
| Molecular Formula | C25H23BrN4O4S |
| Molecular Weight | 555.45 g/mol |
| Exact Mass | 554.06 |
| IUPAC Name | N-[[(4-benzamidobenzoyl)amino]carbamothioyl]-3-bromo-4-propan-2-yloxybenzamide |
| SMILES | CC(C)Oc1ccc(C(=O)NC(=S)NNC(=O)c2ccc(NC(=O)c3ccccc3)cc2)cc1Br |
| InChI | InChI=1S/C25H23BrN4O4S/c1-15(2)34-21-13-10-18(14-20(21)26)23(32)28-25(35)30-29-24(33)17-8-11-19(12-9-17)27-22(31)16-6-4-3-5-7-16/h3-15H,1-2H3,(H,27,31)(H,29,33)(H2,28,30,32,35) |
| InChIKey | CTQYXYNVXUAJMK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|