C28H29BrN4O4S — CID 17339820
3-bromo-N-[[[4-[(3-methylbenzoyl)amino]benzoyl]amino]carbamothioyl]-4-(3-methylbutoxy)benzamide (PubChem CID 17339820) has the molecular formula C28H29BrN4O4S and a molecular weight of 597.54 g/mol. Its IUPAC name is 3-bromo-N-[[[4-[(3-methylbenzoyl)amino]benzoyl]amino]carbamothioyl]-4-(3-methylbutoxy)benzamide.
| Compound Name | 3-bromo-N-[[[4-[(3-methylbenzoyl)amino]benzoyl]amino]carbamothioyl]-4-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 17339820 |
| Molecular Formula | C28H29BrN4O4S |
| Molecular Weight | 597.54 g/mol |
| Exact Mass | 596.11 |
| IUPAC Name | 3-bromo-N-[[[4-[(3-methylbenzoyl)amino]benzoyl]amino]carbamothioyl]-4-(3-methylbutoxy)benzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc(C(=O)NNC(=S)NC(=O)c3ccc(OCCC(C)C)c(Br)c3)cc2)c1 |
| InChI | InChI=1S/C28H29BrN4O4S/c1-17(2)13-14-37-24-12-9-21(16-23(24)29)26(35)31-28(38)33-32-27(36)19-7-10-22(11-8-19)30-25(34)20-6-4-5-18(3)15-20/h4-12,15-17H,13-14H2,1-3H3,(H,30,34)(H,32,36)(H2,31,33,35,38) |
| InChIKey | SOTJLWXRWAPTLY-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.54 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|