C26H25BrN4O4S — CID 4956241
N-[[(4-benzamidobenzoyl)amino]carbamothioyl]-3-bromo-4-butoxybenzamide (PubChem CID 4956241) has the molecular formula C26H25BrN4O4S and a molecular weight of 569.48 g/mol. Its IUPAC name is N-[[(4-benzamidobenzoyl)amino]carbamothioyl]-3-bromo-4-butoxybenzamide.
| Compound Name | N-[[(4-benzamidobenzoyl)amino]carbamothioyl]-3-bromo-4-butoxybenzamide |
|---|---|
| PubChem CID | 4956241 |
| Molecular Formula | C26H25BrN4O4S |
| Molecular Weight | 569.48 g/mol |
| Exact Mass | 568.08 |
| IUPAC Name | N-[[(4-benzamidobenzoyl)amino]carbamothioyl]-3-bromo-4-butoxybenzamide |
| SMILES | CCCCOc1ccc(C(=O)NC(=S)NNC(=O)c2ccc(NC(=O)c3ccccc3)cc2)cc1Br |
| InChI | InChI=1S/C26H25BrN4O4S/c1-2-3-15-35-22-14-11-19(16-21(22)27)24(33)29-26(36)31-30-25(34)18-9-12-20(13-10-18)28-23(32)17-7-5-4-6-8-17/h4-14,16H,2-3,15H2,1H3,(H,28,32)(H,30,34)(H2,29,31,33,36) |
| InChIKey | PWLOGLTWRKVPGK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.48 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|