C24H22BrN3O3S — CID 17343152
3-bromo-N-[[(4-phenylbenzoyl)amino]carbamothioyl]-4-propoxybenzamide (PubChem CID 17343152) has the molecular formula C24H22BrN3O3S and a molecular weight of 512.43 g/mol. Its IUPAC name is 3-bromo-N-[[(4-phenylbenzoyl)amino]carbamothioyl]-4-propoxybenzamide.
| Compound Name | 3-bromo-N-[[(4-phenylbenzoyl)amino]carbamothioyl]-4-propoxybenzamide |
|---|---|
| PubChem CID | 17343152 |
| Molecular Formula | C24H22BrN3O3S |
| Molecular Weight | 512.43 g/mol |
| Exact Mass | 511.06 |
| IUPAC Name | 3-bromo-N-[[(4-phenylbenzoyl)amino]carbamothioyl]-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)NC(=S)NNC(=O)c2ccc(-c3ccccc3)cc2)cc1Br |
| InChI | InChI=1S/C24H22BrN3O3S/c1-2-14-31-21-13-12-19(15-20(21)25)22(29)26-24(32)28-27-23(30)18-10-8-17(9-11-18)16-6-4-3-5-7-16/h3-13,15H,2,14H2,1H3,(H,27,30)(H2,26,28,29,32) |
| InChIKey | FQHVFHLRSIICGF-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.43 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|