C29H24BrN3O3S — CID 17073139
3-bromo-N-[[(4-phenylbenzoyl)amino]carbamothioyl]-4-(2-phenylethoxy)benzamide (PubChem CID 17073139) has the molecular formula C29H24BrN3O3S and a molecular weight of 574.50 g/mol. Its IUPAC name is 3-bromo-N-[[(4-phenylbenzoyl)amino]carbamothioyl]-4-(2-phenylethoxy)benzamide.
| Compound Name | 3-bromo-N-[[(4-phenylbenzoyl)amino]carbamothioyl]-4-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 17073139 |
| Molecular Formula | C29H24BrN3O3S |
| Molecular Weight | 574.50 g/mol |
| Exact Mass | 573.07 |
| IUPAC Name | 3-bromo-N-[[(4-phenylbenzoyl)amino]carbamothioyl]-4-(2-phenylethoxy)benzamide |
| SMILES | O=C(NNC(=S)NC(=O)c1ccc(OCCc2ccccc2)c(Br)c1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H24BrN3O3S/c30-25-19-24(15-16-26(25)36-18-17-20-7-3-1-4-8-20)27(34)31-29(37)33-32-28(35)23-13-11-22(12-14-23)21-9-5-2-6-10-21/h1-16,19H,17-18H2,(H,32,35)(H2,31,33,34,37) |
| InChIKey | DYJAKTGTESVAGV-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.50 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|