C28H23Br2N3O4S — CID 17073163
3-bromo-N-[[[2-(1-bromonaphthalen-2-yl)oxyacetyl]amino]carbamothioyl]-4-(2-phenylethoxy)benzamide (PubChem CID 17073163) has the molecular formula C28H23Br2N3O4S and a molecular weight of 657.38 g/mol. Its IUPAC name is 3-bromo-N-[[[2-(1-bromonaphthalen-2-yl)oxyacetyl]amino]carbamothioyl]-4-(2-phenylethoxy)benzamide.
| Compound Name | 3-bromo-N-[[[2-(1-bromonaphthalen-2-yl)oxyacetyl]amino]carbamothioyl]-4-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 17073163 |
| Molecular Formula | C28H23Br2N3O4S |
| Molecular Weight | 657.38 g/mol |
| Exact Mass | 654.98 |
| IUPAC Name | 3-bromo-N-[[[2-(1-bromonaphthalen-2-yl)oxyacetyl]amino]carbamothioyl]-4-(2-phenylethoxy)benzamide |
| SMILES | O=C(COc1ccc2ccccc2c1Br)NNC(=S)NC(=O)c1ccc(OCCc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C28H23Br2N3O4S/c29-22-16-20(11-12-23(22)36-15-14-18-6-2-1-3-7-18)27(35)31-28(38)33-32-25(34)17-37-24-13-10-19-8-4-5-9-21(19)26(24)30/h1-13,16H,14-15,17H2,(H,32,34)(H2,31,33,35,38) |
| InChIKey | VQEWNXZZUCKIIM-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.38 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|