C27H23BrN2O4 — CID 17134491
N'-[2-(1-bromonaphthalen-2-yl)oxyacetyl]-3-(2-phenylethoxy)benzohydrazide (PubChem CID 17134491) has the molecular formula C27H23BrN2O4 and a molecular weight of 519.40 g/mol. Its IUPAC name is N'-[2-(1-bromonaphthalen-2-yl)oxyacetyl]-3-(2-phenylethoxy)benzohydrazide.
| Compound Name | N'-[2-(1-bromonaphthalen-2-yl)oxyacetyl]-3-(2-phenylethoxy)benzohydrazide |
|---|---|
| PubChem CID | 17134491 |
| Molecular Formula | C27H23BrN2O4 |
| Molecular Weight | 519.40 g/mol |
| Exact Mass | 518.08 |
| IUPAC Name | N'-[2-(1-bromonaphthalen-2-yl)oxyacetyl]-3-(2-phenylethoxy)benzohydrazide |
| SMILES | O=C(COc1ccc2ccccc2c1Br)NNC(=O)c1cccc(OCCc2ccccc2)c1 |
| InChI | InChI=1S/C27H23BrN2O4/c28-26-23-12-5-4-9-20(23)13-14-24(26)34-18-25(31)29-30-27(32)21-10-6-11-22(17-21)33-16-15-19-7-2-1-3-8-19/h1-14,17H,15-16,18H2,(H,29,31)(H,30,32) |
| InChIKey | UTSUSQSHUADQIW-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.40 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|