C23H20BrClN2O4 — CID 17134531
N'-[2-(4-bromo-2-chlorophenoxy)acetyl]-3-(2-phenylethoxy)benzohydrazide (PubChem CID 17134531) has the molecular formula C23H20BrClN2O4 and a molecular weight of 503.78 g/mol. Its IUPAC name is N'-[2-(4-bromo-2-chlorophenoxy)acetyl]-3-(2-phenylethoxy)benzohydrazide.
| Compound Name | N'-[2-(4-bromo-2-chlorophenoxy)acetyl]-3-(2-phenylethoxy)benzohydrazide |
|---|---|
| PubChem CID | 17134531 |
| Molecular Formula | C23H20BrClN2O4 |
| Molecular Weight | 503.78 g/mol |
| Exact Mass | 502.03 |
| IUPAC Name | N'-[2-(4-bromo-2-chlorophenoxy)acetyl]-3-(2-phenylethoxy)benzohydrazide |
| SMILES | O=C(COc1ccc(Br)cc1Cl)NNC(=O)c1cccc(OCCc2ccccc2)c1 |
| InChI | InChI=1S/C23H20BrClN2O4/c24-18-9-10-21(20(25)14-18)31-15-22(28)26-27-23(29)17-7-4-8-19(13-17)30-12-11-16-5-2-1-3-6-16/h1-10,13-14H,11-12,15H2,(H,26,28)(H,27,29) |
| InChIKey | QHXBQUYSNPDPLY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.78 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|