C23H21N3O6 — CID 17134509
N'-[2-(4-nitrophenoxy)acetyl]-3-(2-phenylethoxy)benzohydrazide (PubChem CID 17134509) has the molecular formula C23H21N3O6 and a molecular weight of 435.44 g/mol. Its IUPAC name is N'-[2-(4-nitrophenoxy)acetyl]-3-(2-phenylethoxy)benzohydrazide.
| Compound Name | N'-[2-(4-nitrophenoxy)acetyl]-3-(2-phenylethoxy)benzohydrazide |
|---|---|
| PubChem CID | 17134509 |
| Molecular Formula | C23H21N3O6 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | N'-[2-(4-nitrophenoxy)acetyl]-3-(2-phenylethoxy)benzohydrazide |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1)NNC(=O)c1cccc(OCCc2ccccc2)c1 |
| InChI | InChI=1S/C23H21N3O6/c27-22(16-32-20-11-9-19(10-12-20)26(29)30)24-25-23(28)18-7-4-8-21(15-18)31-14-13-17-5-2-1-3-6-17/h1-12,15H,13-14,16H2,(H,24,27)(H,25,28) |
| InChIKey | KTMMOSOCDZRBRB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|