C27H30N2O4 — CID 17134546
N'-[4-(3-methylbutoxy)benzoyl]-3-(2-phenylethoxy)benzohydrazide (PubChem CID 17134546) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is N'-[4-(3-methylbutoxy)benzoyl]-3-(2-phenylethoxy)benzohydrazide.
| Compound Name | N'-[4-(3-methylbutoxy)benzoyl]-3-(2-phenylethoxy)benzohydrazide |
|---|---|
| PubChem CID | 17134546 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | N'-[4-(3-methylbutoxy)benzoyl]-3-(2-phenylethoxy)benzohydrazide |
| SMILES | CC(C)CCOc1ccc(C(=O)NNC(=O)c2cccc(OCCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C27H30N2O4/c1-20(2)15-17-32-24-13-11-22(12-14-24)26(30)28-29-27(31)23-9-6-10-25(19-23)33-18-16-21-7-4-3-5-8-21/h3-14,19-20H,15-18H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | LJROVFRAEVZLOA-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|