C27H29BrN2O4 — CID 17046444
5-bromo-N'-[4-(3-methylbutoxy)benzoyl]-2-(2-phenylethoxy)benzohydrazide (PubChem CID 17046444) has the molecular formula C27H29BrN2O4 and a molecular weight of 525.44 g/mol. Its IUPAC name is 5-bromo-N'-[4-(3-methylbutoxy)benzoyl]-2-(2-phenylethoxy)benzohydrazide.
| Compound Name | 5-bromo-N'-[4-(3-methylbutoxy)benzoyl]-2-(2-phenylethoxy)benzohydrazide |
|---|---|
| PubChem CID | 17046444 |
| Molecular Formula | C27H29BrN2O4 |
| Molecular Weight | 525.44 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | 5-bromo-N'-[4-(3-methylbutoxy)benzoyl]-2-(2-phenylethoxy)benzohydrazide |
| SMILES | CC(C)CCOc1ccc(C(=O)NNC(=O)c2cc(Br)ccc2OCCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H29BrN2O4/c1-19(2)14-16-33-23-11-8-21(9-12-23)26(31)29-30-27(32)24-18-22(28)10-13-25(24)34-17-15-20-6-4-3-5-7-20/h3-13,18-19H,14-17H2,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | UJZBWTYNOSDPSD-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.44 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|