C24H30BrN3O4S — CID 17351237
5-bromo-2-(3-methylbutoxy)-N-[[[4-(2-methylpropoxy)benzoyl]amino]carbamothioyl]benzamide (PubChem CID 17351237) has the molecular formula C24H30BrN3O4S and a molecular weight of 536.49 g/mol. Its IUPAC name is 5-bromo-2-(3-methylbutoxy)-N-[[[4-(2-methylpropoxy)benzoyl]amino]carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-(3-methylbutoxy)-N-[[[4-(2-methylpropoxy)benzoyl]amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17351237 |
| Molecular Formula | C24H30BrN3O4S |
| Molecular Weight | 536.49 g/mol |
| Exact Mass | 535.11 |
| IUPAC Name | 5-bromo-2-(3-methylbutoxy)-N-[[[4-(2-methylpropoxy)benzoyl]amino]carbamothioyl]benzamide |
| SMILES | CC(C)CCOc1ccc(Br)cc1C(=O)NC(=S)NNC(=O)c1ccc(OCC(C)C)cc1 |
| InChI | InChI=1S/C24H30BrN3O4S/c1-15(2)11-12-31-21-10-7-18(25)13-20(21)23(30)26-24(33)28-27-22(29)17-5-8-19(9-6-17)32-14-16(3)4/h5-10,13,15-16H,11-12,14H2,1-4H3,(H,27,29)(H2,26,28,30,33) |
| InChIKey | AMRAPZYXQZISRX-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.49 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|