C21H23BrN4O6S — CID 17351198
5-bromo-2-(3-methylbutoxy)-N-[[[2-(4-nitrophenoxy)acetyl]amino]carbamothioyl]benzamide (PubChem CID 17351198) has the molecular formula C21H23BrN4O6S and a molecular weight of 539.41 g/mol. Its IUPAC name is 5-bromo-2-(3-methylbutoxy)-N-[[[2-(4-nitrophenoxy)acetyl]amino]carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-(3-methylbutoxy)-N-[[[2-(4-nitrophenoxy)acetyl]amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17351198 |
| Molecular Formula | C21H23BrN4O6S |
| Molecular Weight | 539.41 g/mol |
| Exact Mass | 538.05 |
| IUPAC Name | 5-bromo-2-(3-methylbutoxy)-N-[[[2-(4-nitrophenoxy)acetyl]amino]carbamothioyl]benzamide |
| SMILES | CC(C)CCOc1ccc(Br)cc1C(=O)NC(=S)NNC(=O)COc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H23BrN4O6S/c1-13(2)9-10-31-18-8-3-14(22)11-17(18)20(28)23-21(33)25-24-19(27)12-32-16-6-4-15(5-7-16)26(29)30/h3-8,11,13H,9-10,12H2,1-2H3,(H,24,27)(H2,23,25,28,33) |
| InChIKey | LLZICDZIQSFZCX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|