C18H26BrN3O4S — CID 17358076
5-bromo-N-[(3-ethoxypropanoylamino)carbamothioyl]-2-(3-methylbutoxy)benzamide (PubChem CID 17358076) has the molecular formula C18H26BrN3O4S and a molecular weight of 460.39 g/mol. Its IUPAC name is 5-bromo-N-[(3-ethoxypropanoylamino)carbamothioyl]-2-(3-methylbutoxy)benzamide.
| Compound Name | 5-bromo-N-[(3-ethoxypropanoylamino)carbamothioyl]-2-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 17358076 |
| Molecular Formula | C18H26BrN3O4S |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | 5-bromo-N-[(3-ethoxypropanoylamino)carbamothioyl]-2-(3-methylbutoxy)benzamide |
| SMILES | CCOCCC(=O)NNC(=S)NC(=O)c1cc(Br)ccc1OCCC(C)C |
| InChI | InChI=1S/C18H26BrN3O4S/c1-4-25-9-8-16(23)21-22-18(27)20-17(24)14-11-13(19)5-6-15(14)26-10-7-12(2)3/h5-6,11-12H,4,7-10H2,1-3H3,(H,21,23)(H2,20,22,24,27) |
| InChIKey | MWOKXRUMDTZZCG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|