C26H27BrN2O4 — CID 17350916
5-bromo-2-(3-methylbutoxy)-N'-[2-(4-phenylphenoxy)acetyl]benzohydrazide (PubChem CID 17350916) has the molecular formula C26H27BrN2O4 and a molecular weight of 511.42 g/mol. Its IUPAC name is 5-bromo-2-(3-methylbutoxy)-N'-[2-(4-phenylphenoxy)acetyl]benzohydrazide.
| Compound Name | 5-bromo-2-(3-methylbutoxy)-N'-[2-(4-phenylphenoxy)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 17350916 |
| Molecular Formula | C26H27BrN2O4 |
| Molecular Weight | 511.42 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | 5-bromo-2-(3-methylbutoxy)-N'-[2-(4-phenylphenoxy)acetyl]benzohydrazide |
| SMILES | CC(C)CCOc1ccc(Br)cc1C(=O)NNC(=O)COc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H27BrN2O4/c1-18(2)14-15-32-24-13-10-21(27)16-23(24)26(31)29-28-25(30)17-33-22-11-8-20(9-12-22)19-6-4-3-5-7-19/h3-13,16,18H,14-15,17H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | MOWYDRPLRLQQRN-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.42 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|