C19H21BrN2O6 — CID 17357334
5-bromo-2-(2-methoxyethoxy)-N'-[2-(4-methoxyphenoxy)acetyl]benzohydrazide (PubChem CID 17357334) has the molecular formula C19H21BrN2O6 and a molecular weight of 453.29 g/mol. Its IUPAC name is 5-bromo-2-(2-methoxyethoxy)-N'-[2-(4-methoxyphenoxy)acetyl]benzohydrazide.
| Compound Name | 5-bromo-2-(2-methoxyethoxy)-N'-[2-(4-methoxyphenoxy)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 17357334 |
| Molecular Formula | C19H21BrN2O6 |
| Molecular Weight | 453.29 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 5-bromo-2-(2-methoxyethoxy)-N'-[2-(4-methoxyphenoxy)acetyl]benzohydrazide |
| SMILES | COCCOc1ccc(Br)cc1C(=O)NNC(=O)COc1ccc(OC)cc1 |
| InChI | InChI=1S/C19H21BrN2O6/c1-25-9-10-27-17-8-3-13(20)11-16(17)19(24)22-21-18(23)12-28-15-6-4-14(26-2)5-7-15/h3-8,11H,9-10,12H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | KGGUODHAWYDHCV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|