C20H23BrN2O5 — CID 17357343
5-bromo-N'-[2-(2,6-dimethylphenoxy)acetyl]-2-(2-methoxyethoxy)benzohydrazide (PubChem CID 17357343) has the molecular formula C20H23BrN2O5 and a molecular weight of 451.32 g/mol. Its IUPAC name is 5-bromo-N'-[2-(2,6-dimethylphenoxy)acetyl]-2-(2-methoxyethoxy)benzohydrazide.
| Compound Name | 5-bromo-N'-[2-(2,6-dimethylphenoxy)acetyl]-2-(2-methoxyethoxy)benzohydrazide |
|---|---|
| PubChem CID | 17357343 |
| Molecular Formula | C20H23BrN2O5 |
| Molecular Weight | 451.32 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 5-bromo-N'-[2-(2,6-dimethylphenoxy)acetyl]-2-(2-methoxyethoxy)benzohydrazide |
| SMILES | COCCOc1ccc(Br)cc1C(=O)NNC(=O)COc1c(C)cccc1C |
| InChI | InChI=1S/C20H23BrN2O5/c1-13-5-4-6-14(2)19(13)28-12-18(24)22-23-20(25)16-11-15(21)7-8-17(16)27-10-9-26-3/h4-8,11H,9-10,12H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | HMCXXAJBMRGRKE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|