C21H23Br3N2O4 — CID 17350895
5-bromo-N'-[2-(2,4-dibromo-6-methylphenoxy)acetyl]-2-(3-methylbutoxy)benzohydrazide (PubChem CID 17350895) has the molecular formula C21H23Br3N2O4 and a molecular weight of 607.14 g/mol. Its IUPAC name is 5-bromo-N'-[2-(2,4-dibromo-6-methylphenoxy)acetyl]-2-(3-methylbutoxy)benzohydrazide.
| Compound Name | 5-bromo-N'-[2-(2,4-dibromo-6-methylphenoxy)acetyl]-2-(3-methylbutoxy)benzohydrazide |
|---|---|
| PubChem CID | 17350895 |
| Molecular Formula | C21H23Br3N2O4 |
| Molecular Weight | 607.14 g/mol |
| Exact Mass | 603.92 |
| IUPAC Name | 5-bromo-N'-[2-(2,4-dibromo-6-methylphenoxy)acetyl]-2-(3-methylbutoxy)benzohydrazide |
| SMILES | Cc1cc(Br)cc(Br)c1OCC(=O)NNC(=O)c1cc(Br)ccc1OCCC(C)C |
| InChI | InChI=1S/C21H23Br3N2O4/c1-12(2)6-7-29-18-5-4-14(22)9-16(18)21(28)26-25-19(27)11-30-20-13(3)8-15(23)10-17(20)24/h4-5,8-10,12H,6-7,11H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | LQVNXXZWXTZUHX-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.14 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|