C21H24Br2N2O4 — CID 4946860
N'-[2-(2,4-dibromo-6-methylphenoxy)acetyl]-2-pentoxybenzohydrazide (PubChem CID 4946860) has the molecular formula C21H24Br2N2O4 and a molecular weight of 528.24 g/mol. Its IUPAC name is N'-[2-(2,4-dibromo-6-methylphenoxy)acetyl]-2-pentoxybenzohydrazide.
| Compound Name | N'-[2-(2,4-dibromo-6-methylphenoxy)acetyl]-2-pentoxybenzohydrazide |
|---|---|
| PubChem CID | 4946860 |
| Molecular Formula | C21H24Br2N2O4 |
| Molecular Weight | 528.24 g/mol |
| Exact Mass | 526.01 |
| IUPAC Name | N'-[2-(2,4-dibromo-6-methylphenoxy)acetyl]-2-pentoxybenzohydrazide |
| SMILES | CCCCCOc1ccccc1C(=O)NNC(=O)COc1c(C)cc(Br)cc1Br |
| InChI | InChI=1S/C21H24Br2N2O4/c1-3-4-7-10-28-18-9-6-5-8-16(18)21(27)25-24-19(26)13-29-20-14(2)11-15(22)12-17(20)23/h5-6,8-9,11-12H,3-4,7,10,13H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | ZQFVCGNHYQSEDA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.24 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|