C17H14Br3N3O3S — CID 3381490
2-bromo-N-[[[2-(2,4-dibromo-6-methylphenoxy)acetyl]amino]carbamothioyl]benzamide (PubChem CID 3381490) has the molecular formula C17H14Br3N3O3S and a molecular weight of 580.10 g/mol. Its IUPAC name is 2-bromo-N-[[[2-(2,4-dibromo-6-methylphenoxy)acetyl]amino]carbamothioyl]benzamide.
| Compound Name | 2-bromo-N-[[[2-(2,4-dibromo-6-methylphenoxy)acetyl]amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3381490 |
| Molecular Formula | C17H14Br3N3O3S |
| Molecular Weight | 580.10 g/mol |
| Exact Mass | 576.83 |
| IUPAC Name | 2-bromo-N-[[[2-(2,4-dibromo-6-methylphenoxy)acetyl]amino]carbamothioyl]benzamide |
| SMILES | Cc1cc(Br)cc(Br)c1OCC(=O)NNC(=S)NC(=O)c1ccccc1Br |
| InChI | InChI=1S/C17H14Br3N3O3S/c1-9-6-10(18)7-13(20)15(9)26-8-14(24)22-23-17(27)21-16(25)11-4-2-3-5-12(11)19/h2-7H,8H2,1H3,(H,22,24)(H2,21,23,25,27) |
| InChIKey | JVNZLKVWZCPMJM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.10 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|