C15H15Br2N5O3S — CID 4510147
2-(2,4-dibromo-6-methylphenoxy)-N-[[(5-methyl-1H-pyrazole-3-carbonyl)amino]carbamothioyl]acetamide (PubChem CID 4510147) has the molecular formula C15H15Br2N5O3S and a molecular weight of 505.19 g/mol. Its IUPAC name is 2-(2,4-dibromo-6-methylphenoxy)-N-[[(5-methyl-1H-pyrazole-3-carbonyl)amino]carbamothioyl]acetamide.
| Compound Name | 2-(2,4-dibromo-6-methylphenoxy)-N-[[(5-methyl-1H-pyrazole-3-carbonyl)amino]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 4510147 |
| Molecular Formula | C15H15Br2N5O3S |
| Molecular Weight | 505.19 g/mol |
| Exact Mass | 502.93 |
| IUPAC Name | 2-(2,4-dibromo-6-methylphenoxy)-N-[[(5-methyl-1H-pyrazole-3-carbonyl)amino]carbamothioyl]acetamide |
| SMILES | Cc1cc(C(=O)NNC(=S)NC(=O)COc2c(C)cc(Br)cc2Br)n[nH]1 |
| InChI | InChI=1S/C15H15Br2N5O3S/c1-7-3-9(16)5-10(17)13(7)25-6-12(23)18-15(26)22-21-14(24)11-4-8(2)19-20-11/h3-5H,6H2,1-2H3,(H,19,20)(H,21,24)(H2,18,22,23,26) |
| InChIKey | KUIBGGJJGOAJLY-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 108.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.19 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|