C18H16Br2ClN3O4S — CID 4509663
N-[[[2-(4-chlorophenoxy)acetyl]amino]carbamothioyl]-2-(2,4-dibromo-6-methylphenoxy)acetamide (PubChem CID 4509663) has the molecular formula C18H16Br2ClN3O4S and a molecular weight of 565.67 g/mol. Its IUPAC name is N-[[[2-(4-chlorophenoxy)acetyl]amino]carbamothioyl]-2-(2,4-dibromo-6-methylphenoxy)acetamide.
| Compound Name | N-[[[2-(4-chlorophenoxy)acetyl]amino]carbamothioyl]-2-(2,4-dibromo-6-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 4509663 |
| Molecular Formula | C18H16Br2ClN3O4S |
| Molecular Weight | 565.67 g/mol |
| Exact Mass | 562.89 |
| IUPAC Name | N-[[[2-(4-chlorophenoxy)acetyl]amino]carbamothioyl]-2-(2,4-dibromo-6-methylphenoxy)acetamide |
| SMILES | Cc1cc(Br)cc(Br)c1OCC(=O)NC(=S)NNC(=O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16Br2ClN3O4S/c1-10-6-11(19)7-14(20)17(10)28-8-15(25)22-18(29)24-23-16(26)9-27-13-4-2-12(21)3-5-13/h2-7H,8-9H2,1H3,(H,23,26)(H2,22,24,25,29) |
| InChIKey | FPGFTYLLOPIJJA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.67 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|