C18H17Br2ClN2O4 — CID 4944212
2-(4-chlorophenoxy)-N'-[2-(2,4-dibromo-6-methylphenoxy)acetyl]propanehydrazide (PubChem CID 4944212) has the molecular formula C18H17Br2ClN2O4 and a molecular weight of 520.61 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N'-[2-(2,4-dibromo-6-methylphenoxy)acetyl]propanehydrazide.
| Compound Name | 2-(4-chlorophenoxy)-N'-[2-(2,4-dibromo-6-methylphenoxy)acetyl]propanehydrazide |
|---|---|
| PubChem CID | 4944212 |
| Molecular Formula | C18H17Br2ClN2O4 |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 517.92 |
| IUPAC Name | 2-(4-chlorophenoxy)-N'-[2-(2,4-dibromo-6-methylphenoxy)acetyl]propanehydrazide |
| SMILES | Cc1cc(Br)cc(Br)c1OCC(=O)NNC(=O)C(C)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H17Br2ClN2O4/c1-10-7-12(19)8-15(20)17(10)26-9-16(24)22-23-18(25)11(2)27-14-5-3-13(21)4-6-14/h3-8,11H,9H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | YQICHDXMPCAWCO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|