C18H17BrCl2N2O4 — CID 2268092
(2S)-N'-[2-(4-bromo-3-methylphenoxy)acetyl]-2-(2,4-dichlorophenoxy)propanehydrazide (PubChem CID 2268092) has the molecular formula C18H17BrCl2N2O4 and a molecular weight of 476.15 g/mol. Its IUPAC name is (2S)-N'-[2-(4-bromo-3-methylphenoxy)acetyl]-2-(2,4-dichlorophenoxy)propanehydrazide.
| Compound Name | (2S)-N'-[2-(4-bromo-3-methylphenoxy)acetyl]-2-(2,4-dichlorophenoxy)propanehydrazide |
|---|---|
| PubChem CID | 2268092 |
| Molecular Formula | C18H17BrCl2N2O4 |
| Molecular Weight | 476.15 g/mol |
| Exact Mass | 473.97 |
| IUPAC Name | (2S)-N'-[2-(4-bromo-3-methylphenoxy)acetyl]-2-(2,4-dichlorophenoxy)propanehydrazide |
| SMILES | Cc1cc(OCC(=O)NNC(=O)[C@H](C)Oc2ccc(Cl)cc2Cl)ccc1Br |
| InChI | InChI=1S/C18H17BrCl2N2O4/c1-10-7-13(4-5-14(10)19)26-9-17(24)22-23-18(25)11(2)27-16-6-3-12(20)8-15(16)21/h3-8,11H,9H2,1-2H3,(H,22,24)(H,23,25)/t11-/m0/s1 |
| InChIKey | KRXMXFGSCUQUIX-NSHDSACASA-N |
| XLogP | 4.06 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.15 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|