C18H17Cl2NO5 — CID 17358791
2-[4-[2-(2,4-dichlorophenoxy)propanoylamino]-3-methylphenoxy]acetic acid (PubChem CID 17358791) has the molecular formula C18H17Cl2NO5 and a molecular weight of 398.24 g/mol. Its IUPAC name is 2-[4-[2-(2,4-dichlorophenoxy)propanoylamino]-3-methylphenoxy]acetic acid.
| Compound Name | 2-[4-[2-(2,4-dichlorophenoxy)propanoylamino]-3-methylphenoxy]acetic acid |
|---|---|
| PubChem CID | 17358791 |
| Molecular Formula | C18H17Cl2NO5 |
| Molecular Weight | 398.24 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | 2-[4-[2-(2,4-dichlorophenoxy)propanoylamino]-3-methylphenoxy]acetic acid |
| SMILES | Cc1cc(OCC(=O)O)ccc1NC(=O)C(C)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H17Cl2NO5/c1-10-7-13(25-9-17(22)23)4-5-15(10)21-18(24)11(2)26-16-6-3-12(19)8-14(16)20/h3-8,11H,9H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | HMKMEASZNKZOQM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.24 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |