C16H12Cl3NO4 — CID 2943352
4-chloro-2-[2-(2,4-dichlorophenoxy)propanoylamino]benzoic acid (PubChem CID 2943352) has the molecular formula C16H12Cl3NO4 and a molecular weight of 388.63 g/mol. Its IUPAC name is 4-chloro-2-[2-(2,4-dichlorophenoxy)propanoylamino]benzoic acid.
| Compound Name | 4-chloro-2-[2-(2,4-dichlorophenoxy)propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 2943352 |
| Molecular Formula | C16H12Cl3NO4 |
| Molecular Weight | 388.63 g/mol |
| Exact Mass | 386.98 |
| IUPAC Name | 4-chloro-2-[2-(2,4-dichlorophenoxy)propanoylamino]benzoic acid |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)Nc1cc(Cl)ccc1C(=O)O |
| InChI | InChI=1S/C16H12Cl3NO4/c1-8(24-14-5-3-9(17)6-12(14)19)15(21)20-13-7-10(18)2-4-11(13)16(22)23/h2-8H,1H3,(H,20,21)(H,22,23) |
| InChIKey | RJVJOZRPKYNXKZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.63 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |